| Compound Information | SONAR Target prediction |
| Name: | 5-azacytidine |
| Unique Identifier: | LOPAC 00652 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C8H12N4O5 |
| Molecular Weight: | 232.11 g/mol |
| X log p: | -0.185 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 54.26 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 9 |
| Rotatable Bond Count: | 2 |
| Canonical Smiles: | NC1N=CN(C2OC(CO)C(O)C2O)C(=O)N=1 |
| Class: | DNA Metabolism |
| Action: | Inhibitor |
| Selectivity: | DNA methyltransferase |
| Generic_name: | Azacitidine |
| Chemical_iupac_name: | 4-amino-1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA10312 |
| Kegg_compound_id: | C11262 |
| Drugbank_id: | APRD00809 |
| Melting_point: | 229 oC |
| H2o_solubility: | 8.9E+004 mg/L |
| Logp: | -3.017 |
| Cas_registry_number: | 320-67-2 |
| Drug_category: | Antimetabolites, Antineoplastic; Enzyme Inhibitors |
| Indication: | For treatment of patients with the following myelodysplastic syndrome subtypes: refractory anemia or refractory anemia with ringed sideroblasts (if accompanied by neutropenia or thrombocytopenia or requiring transfusions), refractory anemia with excess blasts, refractory anemia with excess blasts in transformation, and chronic myelomonocytic leukemia. |
| Pharmacology: | Azacitidine is believed to exert its antineoplastic effects by causing hypomethylation of DNA and direct cytotoxicity on abnormal hematopoietic cells in the bone marrow. The concentration of azacitidine required for maximum inhibition of DNA methylation in vitro does not cause major suppression of DNA synthesis. Hypomethylation may restore normal function to genes that are critical for differentiation and proliferation. The cytotoxic effects of azacitidine cause the death of rapidly dividing cells, including cancer cells that are no longer responsive to normal growth control mechanisms. Non-proliferating cells are relatively insensitive to azacitidine. |
| Mechanism_of_action: | Azacitidine (5-azacytidine) causes hypomethylation of DNA and direct cytotoxicity in abnormal hematopoietic cells in the bone marrow, resulting in cell death. 5-azacytidine is a chemical analogue of the cytosine nucleoside used in DNA and RNA. Cells in the presence of 5-azacytidine incorporate it into DNA during transcription and RNA during translation. The incorporation of 5-azacytidine into DNA or RNA inhibits methyltransferase thereby causing demethylation in that sequence, affecting the way that cell regulation proteins are able to bind to the DNA/RNA substrate. |
| Organisms_affected: | Humans and other mammals |
| Found: 24 nonactive as graph: single | with analogs | 1 2 3 4 5 6 7 8 9 10 Next >> [24] |
| Species: | 4932 |
| Condition: | BY4741 |
| Replicates: | 8 |
| Raw OD Value: r im | 0.7955±0.131348 |
| Normalized OD Score: sc h | 1.0066±0.0178545 |
| Z-Score: | 0.2099±0.48893 |
| p-Value: | 0.69637 |
| Z-Factor: | -8.14865 |
| Fitness Defect: | 0.3619 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 8 | 1 2 Next >> |
| 1805 | 4-amino-1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one |
| 9444 | 4-amino-1-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one |
| 47751 | 4-amino-1-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one |
| 460485 | 4-amino-1-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one |
| 460518 | 4-amino-1-[(2S,3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one |
| 1265902 | 4-amino-1-[(2R,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one |
| internal high similarity DBLink | Rows returned: 1 |
| SPE01502111 | 1.0000 |
| active | Cluster 3538 | Additional Members: 13 | Rows returned: 0 |
Service provided by the
Mike Tyers Laboratory